About N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide
N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide (PubChem CID 2805079) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide |
| PubChem CID | 2805079 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)SCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NOS/c1-10(2,3)9(13)12-7-8-14-11(4,5)6/h7-8H2,1-6H3,(H,12,13) |
| InChIKey | DHFZHJQCLQJJAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide (CID 2805079) is N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide is CC(C)(C)SCCNC(=O)C(C)(C)C.
What is the InChIKey of N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide?
The InChIKey is DHFZHJQCLQJJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-10(2,3)9(13)12-7-8-14-11(4,5)6/h7-8H2,1-6H3,(H,12,13).
What are the key properties of N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide?
N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide has a molecular weight of 217.38 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-tert-butylsulfanylethyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 2805079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).