About 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine
2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine (PubChem CID 2805123) has the molecular formula C8H14N4S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine |
| PubChem CID | 2805123 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine |
| SMILES | CC(C)(C)c1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C8H14N4S/c1-8(2,3)5-4-13-7(11-5)12-6(9)10/h4H,1-3H3,(H4,9,10,11,12) |
| InChIKey | MUDFRCMSPCXFMH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine?
The IUPAC name of 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine (CID 2805123) is 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine?
The canonical SMILES for 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine is CC(C)(C)c1csc(N=C(N)N)n1.
What is the InChIKey of 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine?
The InChIKey is MUDFRCMSPCXFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S/c1-8(2,3)5-4-13-7(11-5)12-6(9)10/h4H,1-3H3,(H4,9,10,11,12).
What are the key properties of 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine?
2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine has a molecular weight of 198.29 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butyl-1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 2805123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).