C9H4F3N5O4S — CID 2805154
5-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole (PubChem CID 2805154) has the molecular formula C9H4F3N5O4S and a molecular weight of 335.22 g/mol. Its IUPAC name is 5-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 2805154 |
| Molecular Formula | C9H4F3N5O4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 5-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H4F3N5O4S/c10-9(11,12)4-1-5(16(18)19)7(6(2-4)17(20)21)22-8-13-3-14-15-8/h1-3H,(H,13,14,15) |
| InChIKey | LKKZODMVGKPQAW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|