About phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate
phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 2805210) has the molecular formula C17H11Cl2NO3
and a molecular weight of 348.19 g/mol. Its IUPAC name is phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 2805210 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H11Cl2NO3/c1-10-14(17(21)22-11-6-3-2-4-7-11)16(20-23-10)15-12(18)8-5-9-13(15)19/h2-9H,1H3 |
| InChIKey | MZZYJWVIQWSIRU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The IUPAC name of phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CID 2805210) is phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate is Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The InChIKey is MZZYJWVIQWSIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2NO3/c1-10-14(17(21)22-11-6-3-2-4-7-11)16(20-23-10)15-12(18)8-5-9-13(15)19/h2-9H,1H3.
What are the key properties of phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate has a molecular weight of 348.19 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 2805210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).