About 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile
5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile (PubChem CID 2805317) has the molecular formula C17H10N2OS2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile.
Molecular Properties
| Compound Name | 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile |
| PubChem CID | 2805317 |
| Molecular Formula | C17H10N2OS2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)oc(-n2cccc2)c1-c1cccs1 |
| InChI | InChI=1S/C17H10N2OS2/c18-11-12-15(13-5-3-9-21-13)17(19-7-1-2-8-19)20-16(12)14-6-4-10-22-14/h1-10H |
| InChIKey | ZTASAJFNUINKNP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile?
The IUPAC name of 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile (CID 2805317) is 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile.
What is the SMILES notation for 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile?
The canonical SMILES for 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile is N#Cc1c(-c2cccs2)oc(-n2cccc2)c1-c1cccs1.
What is the InChIKey of 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile?
The InChIKey is ZTASAJFNUINKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2OS2/c18-11-12-15(13-5-3-9-21-13)17(19-7-1-2-8-19)20-16(12)14-6-4-10-22-14/h1-10H.
What are the key properties of 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile?
5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile has a molecular weight of 322.41 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrol-1-yl-2,4-dithiophen-2-ylfuran-3-carbonitrile is sourced from PubChem (CID 2805317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).