About N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide
N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide (PubChem CID 2805433) has the molecular formula C19H22F2N4O2
and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide |
| PubChem CID | 2805433 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide |
| SMILES | CN(C)c1cccc(N(C)C)c1CNC(=O)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H22F2N4O2/c1-24(2)15-9-6-10-16(25(3)4)12(15)11-22-19(27)23-18(26)17-13(20)7-5-8-14(17)21/h5-10H,11H2,1-4H3,(H2,22,23,26,27) |
| InChIKey | ZHPFWHXNLALGNX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide?
The IUPAC name of N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide (CID 2805433) is N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide is CN(C)c1cccc(N(C)C)c1CNC(=O)NC(=O)c1c(F)cccc1F.
What is the InChIKey of N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide?
The InChIKey is ZHPFWHXNLALGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N4O2/c1-24(2)15-9-6-10-16(25(3)4)12(15)11-22-19(27)23-18(26)17-13(20)7-5-8-14(17)21/h5-10H,11H2,1-4H3,(H2,22,23,26,27).
What are the key properties of N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide?
N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide has a molecular weight of 376.41 g/mol, XLogP of 2.74, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,6-bis(dimethylamino)phenyl]methylcarbamoyl]-2,6-difluorobenzamide is sourced from PubChem (CID 2805433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).