About 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone
1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone (PubChem CID 2805459) has the molecular formula C12H9Cl3N2O
and a molecular weight of 303.58 g/mol. Its IUPAC name is 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone |
| PubChem CID | 2805459 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnn(-c2c(Cl)cc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C12H9Cl3N2O/c1-6-9(7(2)18)5-16-17(6)12-10(14)3-8(13)4-11(12)15/h3-5H,1-2H3 |
| InChIKey | BYUALARVKBHBRF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone?
The IUPAC name of 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone (CID 2805459) is 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone.
What is the SMILES notation for 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone?
The canonical SMILES for 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone is CC(=O)c1cnn(-c2c(Cl)cc(Cl)cc2Cl)c1C.
What is the InChIKey of 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone?
The InChIKey is BYUALARVKBHBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl3N2O/c1-6-9(7(2)18)5-16-17(6)12-10(14)3-8(13)4-11(12)15/h3-5H,1-2H3.
What are the key properties of 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone?
1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone has a molecular weight of 303.58 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-methyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]ethanone is sourced from PubChem (CID 2805459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).