About 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine
1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine (PubChem CID 2805519) has the molecular formula C17H17F3N4O4
and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine |
| PubChem CID | 2805519 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCCC(Cn2cccc2)C1 |
| InChI | InChI=1S/C17H17F3N4O4/c18-17(19,20)13-8-14(23(25)26)16(15(9-13)24(27)28)22-7-3-4-12(11-22)10-21-5-1-2-6-21/h1-2,5-6,8-9,12H,3-4,7,10-11H2 |
| InChIKey | XRVJVOCUGAZYTM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 94.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine?
The IUPAC name of 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine (CID 2805519) is 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine.
What is the SMILES notation for 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine?
The canonical SMILES for 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCCC(Cn2cccc2)C1.
What is the InChIKey of 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine?
The InChIKey is XRVJVOCUGAZYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N4O4/c18-17(19,20)13-8-14(23(25)26)16(15(9-13)24(27)28)22-7-3-4-12(11-22)10-21-5-1-2-6-21/h1-2,5-6,8-9,12H,3-4,7,10-11H2.
What are the key properties of 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine?
1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine has a molecular weight of 398.34 g/mol, XLogP of 4.24, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(pyrrol-1-ylmethyl)piperidine is sourced from PubChem (CID 2805519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).