About methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate
methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate (PubChem CID 2805522) has the molecular formula C7H13N3O2S
and a molecular weight of 203.27 g/mol. Its IUPAC name is methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate |
| PubChem CID | 2805522 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate |
| SMILES | COC(C/N=C(/NC#N)SC)OC |
| InChI | InChI=1S/C7H13N3O2S/c1-11-6(12-2)4-9-7(13-3)10-5-8/h6H,4H2,1-3H3,(H,9,10) |
| InChIKey | ZHBPTABBPNTVFO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate?
The IUPAC name of methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate (CID 2805522) is methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate.
What is the SMILES notation for methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate?
The canonical SMILES for methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate is COC(C/N=C(/NC#N)SC)OC.
What is the InChIKey of methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate?
The InChIKey is ZHBPTABBPNTVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S/c1-11-6(12-2)4-9-7(13-3)10-5-8/h6H,4H2,1-3H3,(H,9,10).
What are the key properties of methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate?
methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate has a molecular weight of 203.27 g/mol, XLogP of 0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyano-N'-(2,2-dimethoxyethyl)carbamimidothioate is sourced from PubChem (CID 2805522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).