About 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine
2-methyl-N-phenylmethoxy-1,3-dithian-5-imine (PubChem CID 2805584) has the molecular formula C12H15NOS2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine.
Molecular Properties
| Compound Name | 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine |
| PubChem CID | 2805584 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine |
| SMILES | CC1SCC(=NOCc2ccccc2)CS1 |
| InChI | InChI=1S/C12H15NOS2/c1-10-15-8-12(9-16-10)13-14-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/b13-12- |
| InChIKey | WOJJVFVWTVAQSV-SEYXRHQNSA-N |
| XLogP | 3.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine?
The IUPAC name of 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine (CID 2805584) is 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine.
What is the SMILES notation for 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine?
The canonical SMILES for 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine is CC1SCC(=NOCc2ccccc2)CS1.
What is the InChIKey of 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine?
The InChIKey is WOJJVFVWTVAQSV-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H15NOS2/c1-10-15-8-12(9-16-10)13-14-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/b13-12-.
What are the key properties of 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine?
2-methyl-N-phenylmethoxy-1,3-dithian-5-imine has a molecular weight of 253.39 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-phenylmethoxy-1,3-dithian-5-imine is sourced from PubChem (CID 2805584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).