About 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide
2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide (PubChem CID 2805621) has the molecular formula C12H14ClNOS2
and a molecular weight of 287.84 g/mol. Its IUPAC name is 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide |
| PubChem CID | 2805621 |
| Molecular Formula | C12H14ClNOS2 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide |
| SMILES | CC1SCC(NC(=O)c2ccccc2Cl)CS1 |
| InChI | InChI=1S/C12H14ClNOS2/c1-8-16-6-9(7-17-8)14-12(15)10-4-2-3-5-11(10)13/h2-5,8-9H,6-7H2,1H3,(H,14,15) |
| InChIKey | CFWHYNBMCNTBNR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide?
The IUPAC name of 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide (CID 2805621) is 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide.
What is the SMILES notation for 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide?
The canonical SMILES for 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide is CC1SCC(NC(=O)c2ccccc2Cl)CS1.
What is the InChIKey of 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide?
The InChIKey is CFWHYNBMCNTBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNOS2/c1-8-16-6-9(7-17-8)14-12(15)10-4-2-3-5-11(10)13/h2-5,8-9H,6-7H2,1H3,(H,14,15).
What are the key properties of 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide?
2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide has a molecular weight of 287.84 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide is sourced from PubChem (CID 2805621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).