About N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide
N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 2805636) has the molecular formula C13H12ClN3O3
and a molecular weight of 293.71 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
Molecular Properties
| Compound Name | N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| PubChem CID | 2805636 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCc2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-8-5-11(17-20-8)16-13(19)12(18)15-7-9-3-2-4-10(14)6-9/h2-6H,7H2,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | ORVZLTJWVNPBGR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide?
The IUPAC name of N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (CID 2805636) is N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
What is the SMILES notation for N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide?
The canonical SMILES for N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide is Cc1cc(NC(=O)C(=O)NCc2cccc(Cl)c2)no1.
What is the InChIKey of N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide?
The InChIKey is ORVZLTJWVNPBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O3/c1-8-5-11(17-20-8)16-13(19)12(18)15-7-9-3-2-4-10(14)6-9/h2-6H,7H2,1H3,(H,15,18)(H,16,17,19).
What are the key properties of N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide?
N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide has a molecular weight of 293.71 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chlorophenyl)methyl]-N'-(5-methyl-1,2-oxazol-3-yl)oxamide is sourced from PubChem (CID 2805636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).