About 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole
5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole (PubChem CID 2805660) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole.
Molecular Properties
| Compound Name | 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole |
| PubChem CID | 2805660 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole |
| SMILES | Cc1nn(C)c(C)c1-n1nncc1C |
| InChI | InChI=1S/C9H13N5/c1-6-5-10-12-14(6)9-7(2)11-13(4)8(9)3/h5H,1-4H3 |
| InChIKey | HMYPRNRPYXKLOU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole?
The IUPAC name of 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole (CID 2805660) is 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole.
What is the SMILES notation for 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole?
The canonical SMILES for 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole is Cc1nn(C)c(C)c1-n1nncc1C.
What is the InChIKey of 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole?
The InChIKey is HMYPRNRPYXKLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5/c1-6-5-10-12-14(6)9-7(2)11-13(4)8(9)3/h5H,1-4H3.
What are the key properties of 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole?
5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole has a molecular weight of 191.24 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole is sourced from PubChem (CID 2805660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).