About 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide
3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide (PubChem CID 2805740) has the molecular formula C11H12N2O3S
and a molecular weight of 252.30 g/mol. Its IUPAC name is 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 2805740 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H12N2O3S/c1-8-11(9(2)16-12-8)17(14,15)13-10-6-4-3-5-7-10/h3-7,13H,1-2H3 |
| InChIKey | YDVWAPHIGLACHM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide (CID 2805740) is 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)Nc1ccccc1.
What is the InChIKey of 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide?
The InChIKey is YDVWAPHIGLACHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-8-11(9(2)16-12-8)17(14,15)13-10-6-4-3-5-7-10/h3-7,13H,1-2H3.
What are the key properties of 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide?
3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide has a molecular weight of 252.30 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-phenyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 2805740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).