C19H28N2O2 — CID 2805775
N-methyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide (PubChem CID 2805775) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N-methyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide.
| Compound Name | N-methyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 2805775 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-methyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(C(=O)c2c(C)c(C)c(C)c(C)c2C)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-11-12(2)14(4)17(15(5)13(11)3)18(22)16-7-9-21(10-8-16)19(23)20-6/h16H,7-10H2,1-6H3,(H,20,23) |
| InChIKey | GXQLKKQCNNLQRU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |