About 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole
5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole (PubChem CID 2805853) has the molecular formula C15H8F6N2O
and a molecular weight of 346.23 g/mol. Its IUPAC name is 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole |
| PubChem CID | 2805853 |
| Molecular Formula | C15H8F6N2O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccn[nH]3)o2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F6N2O/c16-14(17,18)9-5-8(6-10(7-9)15(19,20)21)12-1-2-13(24-12)11-3-4-22-23-11/h1-7H,(H,22,23) |
| InChIKey | WXGYYWNODZSWOX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole?
The IUPAC name of 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole (CID 2805853) is 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole.
What is the SMILES notation for 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole?
The canonical SMILES for 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole is FC(F)(F)c1cc(-c2ccc(-c3ccn[nH]3)o2)cc(C(F)(F)F)c1.
What is the InChIKey of 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole?
The InChIKey is WXGYYWNODZSWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F6N2O/c16-14(17,18)9-5-8(6-10(7-9)15(19,20)21)12-1-2-13(24-12)11-3-4-22-23-11/h1-7H,(H,22,23).
What are the key properties of 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole?
5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole has a molecular weight of 346.23 g/mol, XLogP of 5.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole is sourced from PubChem (CID 2805853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).