C15H8F6N2O — CID 2805853
5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole (PubChem CID 2805853) has the molecular formula C15H8F6N2O and a molecular weight of 346.23 g/mol. Its IUPAC name is 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole.
| Compound Name | 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 2805853 |
| Molecular Formula | C15H8F6N2O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]-1H-pyrazole |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccn[nH]3)o2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F6N2O/c16-14(17,18)9-5-8(6-10(7-9)15(19,20)21)12-1-2-13(24-12)11-3-4-22-23-11/h1-7H,(H,22,23) |
| InChIKey | WXGYYWNODZSWOX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |