About N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide
N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide (PubChem CID 2805887) has the molecular formula C10H17Cl2NO
and a molecular weight of 238.16 g/mol. Its IUPAC name is N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide |
| PubChem CID | 2805887 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCC1CC1(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2NO/c1-9(2,3)8(14)13-5-4-7-6-10(7,11)12/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | BUTNBGSCYPAOMS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide (CID 2805887) is N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)NCCC1CC1(Cl)Cl.
What is the InChIKey of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide?
The InChIKey is BUTNBGSCYPAOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl2NO/c1-9(2,3)8(14)13-5-4-7-6-10(7,11)12/h7H,4-6H2,1-3H3,(H,13,14).
What are the key properties of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide?
N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide has a molecular weight of 238.16 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 2805887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).