About 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one
4-(dimethylamino)-1,1-diphenylbut-3-en-2-one (PubChem CID 2806014) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one.
Molecular Properties
| Compound Name | 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one |
| PubChem CID | 2806014 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one |
| SMILES | CN(C)C=CC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-19(2)14-13-17(20)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,18H,1-2H3 |
| InChIKey | JKRJXPWLKZXGLL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one?
The IUPAC name of 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one (CID 2806014) is 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one.
What is the SMILES notation for 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one?
The canonical SMILES for 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one is CN(C)C=CC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one?
The InChIKey is JKRJXPWLKZXGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-19(2)14-13-17(20)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,18H,1-2H3.
What are the key properties of 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one?
4-(dimethylamino)-1,1-diphenylbut-3-en-2-one has a molecular weight of 265.36 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-1,1-diphenylbut-3-en-2-one is sourced from PubChem (CID 2806014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).