About 5-benzhydryl-1H-pyrazole
5-benzhydryl-1H-pyrazole (PubChem CID 2806015) has the molecular formula C16H14N2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-benzhydryl-1H-pyrazole.
Molecular Properties
| Compound Name | 5-benzhydryl-1H-pyrazole |
| PubChem CID | 2806015 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-benzhydryl-1H-pyrazole |
| SMILES | c1ccc(C(c2ccccc2)c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C16H14N2/c1-3-7-13(8-4-1)16(15-11-12-17-18-15)14-9-5-2-6-10-14/h1-12,16H,(H,17,18) |
| InChIKey | MQENKFASEBTSNQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-benzhydryl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzhydryl-1H-pyrazole?
The IUPAC name of 5-benzhydryl-1H-pyrazole (CID 2806015) is 5-benzhydryl-1H-pyrazole.
What is the SMILES notation for 5-benzhydryl-1H-pyrazole?
The canonical SMILES for 5-benzhydryl-1H-pyrazole is c1ccc(C(c2ccccc2)c2ccn[nH]2)cc1.
What is the InChIKey of 5-benzhydryl-1H-pyrazole?
The InChIKey is MQENKFASEBTSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2/c1-3-7-13(8-4-1)16(15-11-12-17-18-15)14-9-5-2-6-10-14/h1-12,16H,(H,17,18).
What are the key properties of 5-benzhydryl-1H-pyrazole?
5-benzhydryl-1H-pyrazole has a molecular weight of 234.30 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzhydryl-1H-pyrazole is sourced from PubChem (CID 2806015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).