About 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one
3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one (PubChem CID 2806059) has the molecular formula C15H14N2OS3
and a molecular weight of 334.49 g/mol. Its IUPAC name is 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one |
| PubChem CID | 2806059 |
| Molecular Formula | C15H14N2OS3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one |
| SMILES | CSc1nnc(SC2=CC(=O)CC(c3ccccc3)C2)s1 |
| InChI | InChI=1S/C15H14N2OS3/c1-19-14-16-17-15(21-14)20-13-8-11(7-12(18)9-13)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | WDLAIVBTFNPRAO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one?
The IUPAC name of 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one (CID 2806059) is 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one.
What is the SMILES notation for 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one?
The canonical SMILES for 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one is CSc1nnc(SC2=CC(=O)CC(c3ccccc3)C2)s1.
What is the InChIKey of 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one?
The InChIKey is WDLAIVBTFNPRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2OS3/c1-19-14-16-17-15(21-14)20-13-8-11(7-12(18)9-13)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3.
What are the key properties of 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one?
3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one has a molecular weight of 334.49 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-phenylcyclohex-2-en-1-one is sourced from PubChem (CID 2806059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).