About N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide
N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 2806220) has the molecular formula C13H12F3N3OS
and a molecular weight of 315.32 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide |
| PubChem CID | 2806220 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | Cc1nc(CON=C(N)c2ccc(C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C13H12F3N3OS/c1-8-18-11(7-21-8)6-20-19-12(17)9-2-4-10(5-3-9)13(14,15)16/h2-5,7H,6H2,1H3,(H2,17,19) |
| InChIKey | QUGMKOVAGFOLNB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide?
The IUPAC name of N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide (CID 2806220) is N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide.
What is the SMILES notation for N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide?
The canonical SMILES for N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide is Cc1nc(CON=C(N)c2ccc(C(F)(F)F)cc2)cs1.
What is the InChIKey of N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide?
The InChIKey is QUGMKOVAGFOLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3OS/c1-8-18-11(7-21-8)6-20-19-12(17)9-2-4-10(5-3-9)13(14,15)16/h2-5,7H,6H2,1H3,(H2,17,19).
What are the key properties of N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide?
N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide has a molecular weight of 315.32 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-(trifluoromethyl)benzenecarboximidamide is sourced from PubChem (CID 2806220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).