About 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid
2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 2806237) has the molecular formula C13H17NO5S
and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid |
| PubChem CID | 2806237 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H17NO5S/c15-11-3-1-10(2-4-11)9-12(13(16)17)14-5-7-20(18,19)8-6-14/h1-4,12,15H,5-9H2,(H,16,17) |
| InChIKey | WFLIHTZAPGLCMT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid?
The IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid (CID 2806237) is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid.
What is the SMILES notation for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid?
The canonical SMILES for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid is O=C(O)C(Cc1ccc(O)cc1)N1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid?
The InChIKey is WFLIHTZAPGLCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5S/c15-11-3-1-10(2-4-11)9-12(13(16)17)14-5-7-20(18,19)8-6-14/h1-4,12,15H,5-9H2,(H,16,17).
What are the key properties of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid?
2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid has a molecular weight of 299.35 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(4-hydroxyphenyl)propanoic acid is sourced from PubChem (CID 2806237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).