C11H13F2NO2S — CID 2806246
4-[(2,4-difluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 2806246) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 2806246 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C11H13F2NO2S/c12-10-2-1-9(11(13)7-10)8-14-3-5-17(15,16)6-4-14/h1-2,7H,3-6,8H2 |
| InChIKey | ZQLAJUBCCYARBF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |