C14H14N2OS3 — CID 2806357
N-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl)thiophene-2-carboxamide (PubChem CID 2806357) has the molecular formula C14H14N2OS3 and a molecular weight of 322.48 g/mol. Its IUPAC name is N-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl)thiophene-2-carboxamide.
| Compound Name | N-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2806357 |
| Molecular Formula | C14H14N2OS3 |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl)thiophene-2-carboxamide |
| SMILES | CC1c2ccsc2CCN1C(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C14H14N2OS3/c1-9-10-5-8-20-11(10)4-6-16(9)14(18)15-13(17)12-3-2-7-19-12/h2-3,5,7-9H,4,6H2,1H3,(H,15,17,18) |
| InChIKey | VVIYKVKMKBYATL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|