About (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone
(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone (PubChem CID 2806362) has the molecular formula C13H13NOS2
and a molecular weight of 263.39 g/mol. Its IUPAC name is (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone |
| PubChem CID | 2806362 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone |
| SMILES | CC1c2ccsc2CCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C13H13NOS2/c1-9-10-5-8-17-11(10)4-6-14(9)13(15)12-3-2-7-16-12/h2-3,5,7-9H,4,6H2,1H3 |
| InChIKey | YIAQGAPIWBZBNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone?
The IUPAC name of (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone (CID 2806362) is (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone.
What is the SMILES notation for (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone?
The canonical SMILES for (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone is CC1c2ccsc2CCN1C(=O)c1cccs1.
What is the InChIKey of (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone?
The InChIKey is YIAQGAPIWBZBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NOS2/c1-9-10-5-8-17-11(10)4-6-14(9)13(15)12-3-2-7-16-12/h2-3,5,7-9H,4,6H2,1H3.
What are the key properties of (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone?
(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone has a molecular weight of 263.39 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-thiophen-2-ylmethanone is sourced from PubChem (CID 2806362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).