About 5J-040
5J-040 (PubChem CID 2806377) has the molecular formula C15H16F3NO4
and a molecular weight of 331.29 g/mol. Its IUPAC name is diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate.
Molecular Properties
| Compound Name | 5J-040 |
| PubChem CID | 2806377 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNC1=CC=C(C=C1)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C15H16F3NO4/c1-3-22-13(20)12(14(21)23-4-2)9-19-11-7-5-10(6-8-11)15(16,17)18/h5-9,19H,3-4H2,1-2H3 |
| InChIKey | JJXDEKZGHIXHPA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 420 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5J-040 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5J-040?
The IUPAC name of 5J-040 (CID 2806377) is diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate.
What is the SMILES notation for 5J-040?
The canonical SMILES for 5J-040 is CCOC(=O)C(=CNC1=CC=C(C=C1)C(F)(F)F)C(=O)OCC.
What is the InChIKey of 5J-040?
The InChIKey is JJXDEKZGHIXHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO4/c1-3-22-13(20)12(14(21)23-4-2)9-19-11-7-5-10(6-8-11)15(16,17)18/h5-9,19H,3-4H2,1-2H3.
What are the key properties of 5J-040?
5J-040 has a molecular weight of 331.29 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5J-040 is sourced from PubChem (CID 2806377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).