C22H20N2O3 — CID 2806411
6-methoxy-8-nitro-2,4-diphenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 2806411) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 6-methoxy-8-nitro-2,4-diphenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-methoxy-8-nitro-2,4-diphenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 2806411 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 6-methoxy-8-nitro-2,4-diphenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)NC(c1ccccc1)CC2c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c1-27-17-12-19-18(15-8-4-2-5-9-15)14-20(16-10-6-3-7-11-16)23-22(19)21(13-17)24(25)26/h2-13,18,20,23H,14H2,1H3 |
| InChIKey | GRQQEBWLPFHWFS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|