About 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one
6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one (PubChem CID 2806511) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one.
Molecular Properties
| Compound Name | 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one |
| PubChem CID | 2806511 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one |
| SMILES | O=C1OCC/N=C(/c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H13NO2/c18-16-14-9-5-4-8-13(14)15(17-10-11-19-16)12-6-2-1-3-7-12/h1-9H,10-11H2/b17-15- |
| InChIKey | XEWLRZJJSSLIKH-ICFOKQHNSA-N |
| XLogP | 2.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one?
The IUPAC name of 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one (CID 2806511) is 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one.
What is the SMILES notation for 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one?
The canonical SMILES for 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one is O=C1OCC/N=C(/c2ccccc2)c2ccccc21.
What is the InChIKey of 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one?
The InChIKey is XEWLRZJJSSLIKH-ICFOKQHNSA-N. The full InChI is InChI=1S/C16H13NO2/c18-16-14-9-5-4-8-13(14)15(17-10-11-19-16)12-6-2-1-3-7-12/h1-9H,10-11H2/b17-15-.
What are the key properties of 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one?
6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one has a molecular weight of 251.29 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-3,4-dihydro-2,5-benzoxazocin-1-one is sourced from PubChem (CID 2806511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).