About 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide
2,6-dimethylmorpholine-4-carboximidamide;hydrobromide (PubChem CID 2806562) has the molecular formula C7H16BrN3O
and a molecular weight of 238.13 g/mol. Its IUPAC name is 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide.
Molecular Properties
| Compound Name | 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide |
| PubChem CID | 2806562 |
| Molecular Formula | C7H16BrN3O |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide |
| SMILES | Br.[H]/N=C(\N)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C7H15N3O.BrH/c1-5-3-10(7(8)9)4-6(2)11-5;/h5-6H,3-4H2,1-2H3,(H3,8,9);1H |
| InChIKey | QHSSSKMWGGMZMN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide?
The IUPAC name of 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide (CID 2806562) is 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide.
What is the SMILES notation for 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide?
The canonical SMILES for 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide is Br.[H]/N=C(\N)N1CC(C)OC(C)C1.
What is the InChIKey of 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide?
The InChIKey is QHSSSKMWGGMZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O.BrH/c1-5-3-10(7(8)9)4-6(2)11-5;/h5-6H,3-4H2,1-2H3,(H3,8,9);1H.
What are the key properties of 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide?
2,6-dimethylmorpholine-4-carboximidamide;hydrobromide has a molecular weight of 238.13 g/mol, XLogP of 0.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylmorpholine-4-carboximidamide;hydrobromide is sourced from PubChem (CID 2806562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).