C12H19N — CID 2806690
(2,3,4,5,6-pentamethylphenyl)methanamine (PubChem CID 2806690) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentamethylphenyl)methanamine.
| Compound Name | (2,3,4,5,6-pentamethylphenyl)methanamine |
|---|---|
| PubChem CID | 2806690 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2,3,4,5,6-pentamethylphenyl)methanamine |
| SMILES | Cc1c(C)c(C)c(CN)c(C)c1C |
| InChI | InChI=1S/C12H19N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h6,13H2,1-5H3 |
| InChIKey | SKSAJXRVVUDTKL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |