About 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline
6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline (PubChem CID 2806750) has the molecular formula C20H14N4O2
and a molecular weight of 342.36 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline |
| PubChem CID | 2806750 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline |
| SMILES | O=[N+]([O-])c1cccc(C2Nc3ccccc3-c3nc4ccccc4n32)c1 |
| InChI | InChI=1S/C20H14N4O2/c25-24(26)14-7-5-6-13(12-14)19-21-16-9-2-1-8-15(16)20-22-17-10-3-4-11-18(17)23(19)20/h1-12,19,21H |
| InChIKey | RCABTWOEVNTODW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline?
The IUPAC name of 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline (CID 2806750) is 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline.
What is the SMILES notation for 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline?
The canonical SMILES for 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline is O=[N+]([O-])c1cccc(C2Nc3ccccc3-c3nc4ccccc4n32)c1.
What is the InChIKey of 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline?
The InChIKey is RCABTWOEVNTODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O2/c25-24(26)14-7-5-6-13(12-14)19-21-16-9-2-1-8-15(16)20-22-17-10-3-4-11-18(17)23(19)20/h1-12,19,21H.
What are the key properties of 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline?
6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline has a molecular weight of 342.36 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-nitrophenyl)-5,6-dihydrobenzimidazolo[1,2-c]quinazoline is sourced from PubChem (CID 2806750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).