About 1-cyclohexyl-1,3-diazinane-2-thione
1-cyclohexyl-1,3-diazinane-2-thione (PubChem CID 2806812) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 1-cyclohexyl-1,3-diazinane-2-thione.
Molecular Properties
| Compound Name | 1-cyclohexyl-1,3-diazinane-2-thione |
| PubChem CID | 2806812 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-cyclohexyl-1,3-diazinane-2-thione |
| SMILES | S=C1NCCCN1C1CCCCC1 |
| InChI | InChI=1S/C10H18N2S/c13-10-11-7-4-8-12(10)9-5-2-1-3-6-9/h9H,1-8H2,(H,11,13) |
| InChIKey | FESOMPBRLQGIDI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-1,3-diazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-1,3-diazinane-2-thione?
The IUPAC name of 1-cyclohexyl-1,3-diazinane-2-thione (CID 2806812) is 1-cyclohexyl-1,3-diazinane-2-thione.
What is the SMILES notation for 1-cyclohexyl-1,3-diazinane-2-thione?
The canonical SMILES for 1-cyclohexyl-1,3-diazinane-2-thione is S=C1NCCCN1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-1,3-diazinane-2-thione?
The InChIKey is FESOMPBRLQGIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c13-10-11-7-4-8-12(10)9-5-2-1-3-6-9/h9H,1-8H2,(H,11,13).
What are the key properties of 1-cyclohexyl-1,3-diazinane-2-thione?
1-cyclohexyl-1,3-diazinane-2-thione has a molecular weight of 198.33 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-1,3-diazinane-2-thione is sourced from PubChem (CID 2806812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).