About 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile
4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile (PubChem CID 2806828) has the molecular formula C18H23N3S
and a molecular weight of 313.47 g/mol. Its IUPAC name is 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile |
| PubChem CID | 2806828 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccc(CSC2=NCCCN2C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N3S/c19-13-15-7-9-16(10-8-15)14-22-18-20-11-4-12-21(18)17-5-2-1-3-6-17/h7-10,17H,1-6,11-12,14H2 |
| InChIKey | XMPYQNDAKQKLKS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile?
The IUPAC name of 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile (CID 2806828) is 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile.
What is the SMILES notation for 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile?
The canonical SMILES for 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile is N#Cc1ccc(CSC2=NCCCN2C2CCCCC2)cc1.
What is the InChIKey of 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile?
The InChIKey is XMPYQNDAKQKLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3S/c19-13-15-7-9-16(10-8-15)14-22-18-20-11-4-12-21(18)17-5-2-1-3-6-17/h7-10,17H,1-6,11-12,14H2.
What are the key properties of 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile?
4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile has a molecular weight of 313.47 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-cyclohexyl-5,6-dihydro-4H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile is sourced from PubChem (CID 2806828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).