About 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide
3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide (PubChem CID 2807080) has the molecular formula C17H17Cl2NO
and a molecular weight of 322.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide.
Molecular Properties
| Compound Name | 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
| PubChem CID | 2807080 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-10-4-6-14(11(2)8-10)12(3)20-17(21)13-5-7-15(18)16(19)9-13/h4-9,12H,1-3H3,(H,20,21) |
| InChIKey | ZWPIGVNTTYJSKX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide?
The IUPAC name of 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide (CID 2807080) is 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide.
What is the SMILES notation for 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide?
The canonical SMILES for 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide is Cc1ccc(C(C)NC(=O)c2ccc(Cl)c(Cl)c2)c(C)c1.
What is the InChIKey of 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide?
The InChIKey is ZWPIGVNTTYJSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2NO/c1-10-4-6-14(11(2)8-10)12(3)20-17(21)13-5-7-15(18)16(19)9-13/h4-9,12H,1-3H3,(H,20,21).
What are the key properties of 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide?
3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide has a molecular weight of 322.24 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-[1-(2,4-dimethylphenyl)ethyl]benzamide is sourced from PubChem (CID 2807080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).