C11H10Cl3NO2S — CID 2807165
1-(2,4,5-trichlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 2807165) has the molecular formula C11H10Cl3NO2S and a molecular weight of 326.63 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2,4,5-trichlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 2807165 |
| Molecular Formula | C11H10Cl3NO2S |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(c1cc(Cl)c(Cl)cc1Cl)N1CC=CCC1 |
| InChI | InChI=1S/C11H10Cl3NO2S/c12-8-6-10(14)11(7-9(8)13)18(16,17)15-4-2-1-3-5-15/h1-2,6-7H,3-5H2 |
| InChIKey | VZMLPZUKGUNZEM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|