C20H25FN2O3S2 — CID 2807212
N'-(4-fluorophenyl)sulfonyl-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetohydrazide (PubChem CID 2807212) has the molecular formula C20H25FN2O3S2 and a molecular weight of 424.56 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfonyl-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetohydrazide.
| Compound Name | N'-(4-fluorophenyl)sulfonyl-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 2807212 |
| Molecular Formula | C20H25FN2O3S2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N'-(4-fluorophenyl)sulfonyl-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetohydrazide |
| SMILES | Cc1c(C)c(C)c(CSCC(=O)NNS(=O)(=O)c2ccc(F)cc2)c(C)c1C |
| InChI | InChI=1S/C20H25FN2O3S2/c1-12-13(2)15(4)19(16(5)14(12)3)10-27-11-20(24)22-23-28(25,26)18-8-6-17(21)7-9-18/h6-9,23H,10-11H2,1-5H3,(H,22,24) |
| InChIKey | VZWJTFPLBSBSKD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|