About 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole
5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole (PubChem CID 2807349) has the molecular formula C11H10FN3O3
and a molecular weight of 251.22 g/mol. Its IUPAC name is 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole.
Molecular Properties
| Compound Name | 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole |
| PubChem CID | 2807349 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole |
| SMILES | Cc1nn(C)c(Oc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10FN3O3/c1-7-10(15(16)17)11(14(2)13-7)18-9-5-3-8(12)4-6-9/h3-6H,1-2H3 |
| InChIKey | IILWPPLCJITCOI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole?
The IUPAC name of 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole (CID 2807349) is 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole.
What is the SMILES notation for 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole?
The canonical SMILES for 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole is Cc1nn(C)c(Oc2ccc(F)cc2)c1[N+](=O)[O-].
What is the InChIKey of 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole?
The InChIKey is IILWPPLCJITCOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O3/c1-7-10(15(16)17)11(14(2)13-7)18-9-5-3-8(12)4-6-9/h3-6H,1-2H3.
What are the key properties of 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole?
5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole has a molecular weight of 251.22 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenoxy)-1,3-dimethyl-4-nitropyrazole is sourced from PubChem (CID 2807349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).