About 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide
2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide (PubChem CID 2807358) has the molecular formula C10H9Cl2N3O
and a molecular weight of 258.11 g/mol. Its IUPAC name is 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide |
| PubChem CID | 2807358 |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCN1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H9Cl2N3O/c11-6-2-1-3-7(12)8(6)9(16)15-10-13-4-5-14-10/h1-3H,4-5H2,(H2,13,14,15,16) |
| InChIKey | FIEAGGWJKSOGDQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide?
The IUPAC name of 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide (CID 2807358) is 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide.
What is the SMILES notation for 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide?
The canonical SMILES for 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide is O=C(NC1=NCCN1)c1c(Cl)cccc1Cl.
What is the InChIKey of 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide?
The InChIKey is FIEAGGWJKSOGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2N3O/c11-6-2-1-3-7(12)8(6)9(16)15-10-13-4-5-14-10/h1-3H,4-5H2,(H2,13,14,15,16).
What are the key properties of 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide?
2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide has a molecular weight of 258.11 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-N-(4,5-dihydro-1H-imidazol-2-yl)benzamide is sourced from PubChem (CID 2807358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).