About pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate
pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate (PubChem CID 2807425) has the molecular formula C12H11N5O2
and a molecular weight of 257.25 g/mol. Its IUPAC name is pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate.
Analyze pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate?
The IUPAC name of pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate (CID 2807425) is pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate.
What is the SMILES notation for pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate?
The canonical SMILES for pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate is CN(C)C(=O)Oc1ccc2nnc3ccnn3c2c1.
What is the InChIKey of pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate?
The InChIKey is CBEHDZXCPSGRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O2/c1-16(2)12(18)19-8-3-4-9-10(7-8)17-11(15-14-9)5-6-13-17/h3-7H,1-2H3.
What are the key properties of pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate?
pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate has a molecular weight of 257.25 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl N,N-dimethylcarbamate is sourced from PubChem (CID 2807425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).