About 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile
4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile (PubChem CID 2807444) has the molecular formula C20H14N2O3
and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile |
| PubChem CID | 2807444 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile |
| SMILES | COc1nc(-c2ccccc2)cc(-c2ccc3c(c2)OCO3)c1C#N |
| InChI | InChI=1S/C20H14N2O3/c1-23-20-16(11-21)15(10-17(22-20)13-5-3-2-4-6-13)14-7-8-18-19(9-14)25-12-24-18/h2-10H,12H2,1H3 |
| InChIKey | ZGTDCHGEJFYKTO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile (CID 2807444) is 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile is COc1nc(-c2ccccc2)cc(-c2ccc3c(c2)OCO3)c1C#N.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile?
The InChIKey is ZGTDCHGEJFYKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O3/c1-23-20-16(11-21)15(10-17(22-20)13-5-3-2-4-6-13)14-7-8-18-19(9-14)25-12-24-18/h2-10H,12H2,1H3.
What are the key properties of 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile?
4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile has a molecular weight of 330.34 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-2-methoxy-6-phenylpyridine-3-carbonitrile is sourced from PubChem (CID 2807444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).