C16H12FNO2 — CID 2807455
(2,3-dihydroinden-1-ylideneamino) 3-fluorobenzoate (PubChem CID 2807455) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is (2,3-dihydroinden-1-ylideneamino) 3-fluorobenzoate.
| Compound Name | (2,3-dihydroinden-1-ylideneamino) 3-fluorobenzoate |
|---|---|
| PubChem CID | 2807455 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2,3-dihydroinden-1-ylideneamino) 3-fluorobenzoate |
| SMILES | O=C(ON=C1CCc2ccccc21)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12FNO2/c17-13-6-3-5-12(10-13)16(19)20-18-15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2 |
| InChIKey | FSUGMHVOMUBFEG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|