About 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide
4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide (PubChem CID 2807475) has the molecular formula C11H11BrN2S
and a molecular weight of 283.19 g/mol. Its IUPAC name is 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide |
| PubChem CID | 2807475 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide |
| SMILES | Br.Nc1nc2c(s1)CCc1ccccc1-2 |
| InChI | InChI=1S/C11H10N2S.BrH/c12-11-13-10-8-4-2-1-3-7(8)5-6-9(10)14-11;/h1-4H,5-6H2,(H2,12,13);1H |
| InChIKey | MLUCGQJSQHEYRX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide?
The IUPAC name of 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide (CID 2807475) is 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide.
What is the SMILES notation for 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide?
The canonical SMILES for 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide is Br.Nc1nc2c(s1)CCc1ccccc1-2.
What is the InChIKey of 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide?
The InChIKey is MLUCGQJSQHEYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S.BrH/c12-11-13-10-8-4-2-1-3-7(8)5-6-9(10)14-11;/h1-4H,5-6H2,(H2,12,13);1H.
What are the key properties of 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide?
4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide has a molecular weight of 283.19 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine;hydrobromide is sourced from PubChem (CID 2807475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).