C17H20ClN3O2S — CID 2807516
ethyl 2-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 2807516) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is ethyl 2-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2807516 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | ethyl 2-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1sc(NN=C2CCCc3ccccc32)nc1C.Cl |
| InChI | InChI=1S/C17H19N3O2S.ClH/c1-3-22-16(21)15-11(2)18-17(23-15)20-19-14-10-6-8-12-7-4-5-9-13(12)14;/h4-5,7,9H,3,6,8,10H2,1-2H3,(H,18,20);1H |
| InChIKey | ZTJDPLQVIFLFBU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|