C12H7F6NO2 — CID 2807570
1-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 2807570) has the molecular formula C12H7F6NO2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2807570 |
| Molecular Formula | C12H7F6NO2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7F6NO2/c13-11(14,15)6-3-7(12(16,17)18)5-8(4-6)19-9(20)1-2-10(19)21/h3-5H,1-2H2 |
| InChIKey | VGYJDQULIDMYFT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|