About N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide
N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide (PubChem CID 2807704) has the molecular formula C5H4BrCl2N3O
and a molecular weight of 272.92 g/mol. Its IUPAC name is N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide |
| PubChem CID | 2807704 |
| Molecular Formula | C5H4BrCl2N3O |
| Molecular Weight | 272.92 g/mol |
| Exact Mass | 270.89 |
| IUPAC Name | N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide |
| SMILES | O=C(Nc1[nH]ncc1Br)C(Cl)Cl |
| InChI | InChI=1S/C5H4BrCl2N3O/c6-2-1-9-11-4(2)10-5(12)3(7)8/h1,3H,(H2,9,10,11,12) |
| InChIKey | LADRFWUCCBNWBG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide?
The IUPAC name of N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide (CID 2807704) is N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide.
What is the SMILES notation for N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide?
The canonical SMILES for N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide is O=C(Nc1[nH]ncc1Br)C(Cl)Cl.
What is the InChIKey of N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide?
The InChIKey is LADRFWUCCBNWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrCl2N3O/c6-2-1-9-11-4(2)10-5(12)3(7)8/h1,3H,(H2,9,10,11,12).
What are the key properties of N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide?
N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide has a molecular weight of 272.92 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-1H-pyrazol-5-yl)-2,2-dichloroacetamide is sourced from PubChem (CID 2807704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).