About 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide
5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide (PubChem CID 2807844) has the molecular formula C13H8ClF3N2O2S
and a molecular weight of 348.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide |
| PubChem CID | 2807844 |
| Molecular Formula | C13H8ClF3N2O2S |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF3N2O2S/c14-7-3-1-6(2-4-7)9-5-8(10(22-9)11(18)20)19-12(21)13(15,16)17/h1-5H,(H2,18,20)(H,19,21) |
| InChIKey | NXNFPOSVKQTVRP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide (CID 2807844) is 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide is NC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)C(F)(F)F.
What is the InChIKey of 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide?
The InChIKey is NXNFPOSVKQTVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF3N2O2S/c14-7-3-1-6(2-4-7)9-5-8(10(22-9)11(18)20)19-12(21)13(15,16)17/h1-5H,(H2,18,20)(H,19,21).
What are the key properties of 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide?
5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide has a molecular weight of 348.73 g/mol, XLogP of 3.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxamide is sourced from PubChem (CID 2807844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).