About 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea
1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea (PubChem CID 2808000) has the molecular formula C21H18F6N4O
and a molecular weight of 456.39 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea |
| PubChem CID | 2808000 |
| Molecular Formula | C21H18F6N4O |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea |
| SMILES | CCCc1c(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C21H18F6N4O/c1-2-6-18-17(12-28-31(18)16-7-4-3-5-8-16)30-19(32)29-15-10-13(20(22,23)24)9-14(11-15)21(25,26)27/h3-5,7-12H,2,6H2,1H3,(H2,29,30,32) |
| InChIKey | USYCYICOSDCREL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea (CID 2808000) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea is CCCc1c(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cnn1-c1ccccc1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea?
The InChIKey is USYCYICOSDCREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F6N4O/c1-2-6-18-17(12-28-31(18)16-7-4-3-5-8-16)30-19(32)29-15-10-13(20(22,23)24)9-14(11-15)21(25,26)27/h3-5,7-12H,2,6H2,1H3,(H2,29,30,32).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea?
1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea has a molecular weight of 456.39 g/mol, XLogP of 6.51, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1-phenyl-5-propylpyrazol-4-yl)urea is sourced from PubChem (CID 2808000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).