About 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine
4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine (PubChem CID 2808062) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine.
Molecular Properties
| Compound Name | 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine |
| PubChem CID | 2808062 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine |
| SMILES | Cc1csc2c(N3CCOCC3)ncnc12 |
| InChI | InChI=1S/C11H13N3OS/c1-8-6-16-10-9(8)12-7-13-11(10)14-2-4-15-5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | POTLBCOQFFWKMH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine?
The IUPAC name of 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine (CID 2808062) is 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine.
What is the SMILES notation for 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine?
The canonical SMILES for 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine is Cc1csc2c(N3CCOCC3)ncnc12.
What is the InChIKey of 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine?
The InChIKey is POTLBCOQFFWKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c1-8-6-16-10-9(8)12-7-13-11(10)14-2-4-15-5-3-14/h6-7H,2-5H2,1H3.
What are the key properties of 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine?
4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine has a molecular weight of 235.31 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methylthieno[3,2-d]pyrimidin-4-yl)morpholine is sourced from PubChem (CID 2808062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).