C11H9NO4S — CID 2808337
methyl 3-(2,5-dioxopyrrol-1-yl)-4-methylthiophene-2-carboxylate (PubChem CID 2808337) has the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. Its IUPAC name is methyl 3-(2,5-dioxopyrrol-1-yl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(2,5-dioxopyrrol-1-yl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2808337 |
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | methyl 3-(2,5-dioxopyrrol-1-yl)-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H9NO4S/c1-6-5-17-10(11(15)16-2)9(6)12-7(13)3-4-8(12)14/h3-5H,1-2H3 |
| InChIKey | PLWDPIQDDJZHRF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|