C17H9F9N4O2S — CID 2808501
[[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 2808501) has the molecular formula C17H9F9N4O2S and a molecular weight of 504.33 g/mol. Its IUPAC name is [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2808501 |
| Molecular Formula | C17H9F9N4O2S |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 1-methyl-3-(trifluoromethyl)thieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cn1nc(C(F)(F)F)c2cc(C(=O)ON=C(N)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)sc21 |
| InChI | InChI=1S/C17H9F9N4O2S/c1-30-13-9(11(28-30)17(24,25)26)5-10(33-13)14(31)32-29-12(27)6-2-7(15(18,19)20)4-8(3-6)16(21,22)23/h2-5H,1H3,(H2,27,29) |
| InChIKey | RFSHGDLTZWRTSM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|